C24H29N5O2 — CID 54295966
methyl 6-[3-[[N-cyano-N'-(2-methylpropyl)carbamimidoyl]amino]phenyl]-6-pyridin-3-ylhex-5-enoate (PubChem CID 54295966) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is methyl 6-[3-[[N-cyano-N'-(2-methylpropyl)carbamimidoyl]amino]phenyl]-6-pyridin-3-ylhex-5-enoate.
| Compound Name | methyl 6-[3-[[N-cyano-N'-(2-methylpropyl)carbamimidoyl]amino]phenyl]-6-pyridin-3-ylhex-5-enoate |
|---|---|
| PubChem CID | 54295966 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | methyl 6-[3-[[N-cyano-N'-(2-methylpropyl)carbamimidoyl]amino]phenyl]-6-pyridin-3-ylhex-5-enoate |
| SMILES | COC(=O)CCCC=C(c1cccnc1)c1cccc(N/C(=N/CC(C)C)NC#N)c1 |
| InChI | InChI=1S/C24H29N5O2/c1-18(2)15-27-24(28-17-25)29-21-10-6-8-19(14-21)22(20-9-7-13-26-16-20)11-4-5-12-23(30)31-3/h6-11,13-14,16,18H,4-5,12,15H2,1-3H3,(H2,27,28,29) |
| InChIKey | SAUYCENSJUKCOI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|