C14H28N4S2 — CID 154496788
1-methyl-3-[[(1S,5R)-1,3,3-trimethyl-5-(methylcarbamothioylamino)cyclohexyl]methyl]thiourea (PubChem CID 154496788) has the molecular formula C14H28N4S2 and a molecular weight of 316.54 g/mol. Its IUPAC name is 1-methyl-3-[[(1S,5R)-1,3,3-trimethyl-5-(methylcarbamothioylamino)cyclohexyl]methyl]thiourea.
| Compound Name | 1-methyl-3-[[(1S,5R)-1,3,3-trimethyl-5-(methylcarbamothioylamino)cyclohexyl]methyl]thiourea |
|---|---|
| PubChem CID | 154496788 |
| Molecular Formula | C14H28N4S2 |
| Molecular Weight | 316.54 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 1-methyl-3-[[(1S,5R)-1,3,3-trimethyl-5-(methylcarbamothioylamino)cyclohexyl]methyl]thiourea |
| SMILES | CNC(=S)NC[C@]1(C)C[C@H](NC(=S)NC)CC(C)(C)C1 |
| InChI | InChI=1S/C14H28N4S2/c1-13(2)6-10(18-12(20)16-5)7-14(3,8-13)9-17-11(19)15-4/h10H,6-9H2,1-5H3,(H2,15,17,19)(H2,16,18,20)/t10-,14-/m1/s1 |
| InChIKey | KEJFAGMNOBNFJR-QMTHXVAHSA-N |
| XLogP | 1.76 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.54 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|