C25H18ClFN4O2S2 — CID 154506559
(6S)-3-(2-chlorophenyl)-6-[6-[(6-fluoro-3-pyridinyl)amino]-2-pyridinyl]-1-sulfanyl-6-thiophen-3-ylpiperidine-2,4-dione (PubChem CID 154506559) has the molecular formula C25H18ClFN4O2S2 and a molecular weight of 525.03 g/mol. Its IUPAC name is (6S)-3-(2-chlorophenyl)-6-[6-[(6-fluoro-3-pyridinyl)amino]-2-pyridinyl]-1-sulfanyl-6-thiophen-3-ylpiperidine-2,4-dione.
| Compound Name | (6S)-3-(2-chlorophenyl)-6-[6-[(6-fluoro-3-pyridinyl)amino]-2-pyridinyl]-1-sulfanyl-6-thiophen-3-ylpiperidine-2,4-dione |
|---|---|
| PubChem CID | 154506559 |
| Molecular Formula | C25H18ClFN4O2S2 |
| Molecular Weight | 525.03 g/mol |
| Exact Mass | 524.05 |
| IUPAC Name | (6S)-3-(2-chlorophenyl)-6-[6-[(6-fluoro-3-pyridinyl)amino]-2-pyridinyl]-1-sulfanyl-6-thiophen-3-ylpiperidine-2,4-dione |
| SMILES | O=C1C[C@](c2ccsc2)(c2cccc(Nc3ccc(F)nc3)n2)N(S)C(=O)C1c1ccccc1Cl |
| InChI | InChI=1S/C25H18ClFN4O2S2/c26-18-5-2-1-4-17(18)23-19(32)12-25(31(34)24(23)33,15-10-11-35-14-15)20-6-3-7-22(30-20)29-16-8-9-21(27)28-13-16/h1-11,13-14,23,34H,12H2,(H,29,30)/t23?,25-/m0/s1 |
| InChIKey | MQUSALOUNYHVKZ-YNMFNDETSA-N |
| XLogP | 5.75 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.03 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|