C13H7Cl2F3O — CID 154508539
1,3-dichloro-5-[2-(trifluoromethyl)phenoxy]benzene (PubChem CID 154508539) has the molecular formula C13H7Cl2F3O and a molecular weight of 307.10 g/mol. Its IUPAC name is 1,3-dichloro-5-[2-(trifluoromethyl)phenoxy]benzene.
| Compound Name | 1,3-dichloro-5-[2-(trifluoromethyl)phenoxy]benzene |
|---|---|
| PubChem CID | 154508539 |
| Molecular Formula | C13H7Cl2F3O |
| Molecular Weight | 307.10 g/mol |
| Exact Mass | 305.98 |
| IUPAC Name | 1,3-dichloro-5-[2-(trifluoromethyl)phenoxy]benzene |
| SMILES | FC(F)(F)c1ccccc1Oc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H7Cl2F3O/c14-8-5-9(15)7-10(6-8)19-12-4-2-1-3-11(12)13(16,17)18/h1-7H |
| InChIKey | MLYDSFUOIMZUCT-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.10 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |