About 7-methyl-7-propyl-1,2,3,5,6,8-hexahydropyrrolizine
7-methyl-7-propyl-1,2,3,5,6,8-hexahydropyrrolizine (PubChem CID 154510933) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is 7-methyl-7-propyl-1,2,3,5,6,8-hexahydropyrrolizine.
Analyze 7-methyl-7-propyl-1,2,3,5,6,8-hexahydropyrrolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-7-propyl-1,2,3,5,6,8-hexahydropyrrolizine?
The IUPAC name of 7-methyl-7-propyl-1,2,3,5,6,8-hexahydropyrrolizine (CID 154510933) is 7-methyl-7-propyl-1,2,3,5,6,8-hexahydropyrrolizine.
What is the SMILES notation for 7-methyl-7-propyl-1,2,3,5,6,8-hexahydropyrrolizine?
The canonical SMILES for 7-methyl-7-propyl-1,2,3,5,6,8-hexahydropyrrolizine is CCCC1(C)CCN2CCCC21.
What is the InChIKey of 7-methyl-7-propyl-1,2,3,5,6,8-hexahydropyrrolizine?
The InChIKey is WTJHZTNTWPDZJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N/c1-3-6-11(2)7-9-12-8-4-5-10(11)12/h10H,3-9H2,1-2H3.
What are the key properties of 7-methyl-7-propyl-1,2,3,5,6,8-hexahydropyrrolizine?
7-methyl-7-propyl-1,2,3,5,6,8-hexahydropyrrolizine has a molecular weight of 167.30 g/mol, XLogP of 2.66, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-7-propyl-1,2,3,5,6,8-hexahydropyrrolizine is sourced from PubChem (CID 154510933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).