C10H22N4 — CID 83010988
[1-(2,2-dimethylhydrazinyl)-2,3,5,6,7,8-hexahydropyrrolizin-1-yl]methanamine (PubChem CID 83010988) has the molecular formula C10H22N4 and a molecular weight of 198.31 g/mol. Its IUPAC name is [1-(2,2-dimethylhydrazinyl)-2,3,5,6,7,8-hexahydropyrrolizin-1-yl]methanamine.
| Compound Name | [1-(2,2-dimethylhydrazinyl)-2,3,5,6,7,8-hexahydropyrrolizin-1-yl]methanamine |
|---|---|
| PubChem CID | 83010988 |
| Molecular Formula | C10H22N4 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | [1-(2,2-dimethylhydrazinyl)-2,3,5,6,7,8-hexahydropyrrolizin-1-yl]methanamine |
| SMILES | CN(C)NC1(CN)CCN2CCCC21 |
| InChI | InChI=1S/C10H22N4/c1-13(2)12-10(8-11)5-7-14-6-3-4-9(10)14/h9,12H,3-8,11H2,1-2H3 |
| InChIKey | UWYPJDMXNJOXNM-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|