C11H21N3 — CID 82853328
1-(aminomethyl)-N-prop-2-enyl-2,3,5,6,7,8-hexahydropyrrolizin-1-amine (PubChem CID 82853328) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-(aminomethyl)-N-prop-2-enyl-2,3,5,6,7,8-hexahydropyrrolizin-1-amine.
| Compound Name | 1-(aminomethyl)-N-prop-2-enyl-2,3,5,6,7,8-hexahydropyrrolizin-1-amine |
|---|---|
| PubChem CID | 82853328 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 1-(aminomethyl)-N-prop-2-enyl-2,3,5,6,7,8-hexahydropyrrolizin-1-amine |
| SMILES | C=CCNC1(CN)CCN2CCCC21 |
| InChI | InChI=1S/C11H21N3/c1-2-6-13-11(9-12)5-8-14-7-3-4-10(11)14/h2,10,13H,1,3-9,12H2 |
| InChIKey | OOLZZYKTQNYKDH-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|