C29H28ClFN6O — CID 154515134
3-[3-[2-[2-chloro-4-[4-(2-fluoroethyl)piperazin-1-yl]anilino]quinazolin-8-yl]phenyl]prop-2-enamide (PubChem CID 154515134) has the molecular formula C29H28ClFN6O and a molecular weight of 531.04 g/mol. Its IUPAC name is 3-[3-[2-[2-chloro-4-[4-(2-fluoroethyl)piperazin-1-yl]anilino]quinazolin-8-yl]phenyl]prop-2-enamide.
| Compound Name | 3-[3-[2-[2-chloro-4-[4-(2-fluoroethyl)piperazin-1-yl]anilino]quinazolin-8-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 154515134 |
| Molecular Formula | C29H28ClFN6O |
| Molecular Weight | 531.04 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | 3-[3-[2-[2-chloro-4-[4-(2-fluoroethyl)piperazin-1-yl]anilino]quinazolin-8-yl]phenyl]prop-2-enamide |
| SMILES | NC(=O)C=Cc1cccc(-c2cccc3cnc(Nc4ccc(N5CCN(CCF)CC5)cc4Cl)nc23)c1 |
| InChI | InChI=1S/C29H28ClFN6O/c30-25-18-23(37-15-13-36(12-11-31)14-16-37)8-9-26(25)34-29-33-19-22-5-2-6-24(28(22)35-29)21-4-1-3-20(17-21)7-10-27(32)38/h1-10,17-19H,11-16H2,(H2,32,38)(H,33,34,35) |
| InChIKey | IAYCRMLIPIGTJD-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.04 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|