C10H19NO3S — CID 154517344
(2S)-3-(1-acetamidoethylsulfanyl)-2,3-dimethylbutanoic acid (PubChem CID 154517344) has the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. Its IUPAC name is (2S)-3-(1-acetamidoethylsulfanyl)-2,3-dimethylbutanoic acid.
| Compound Name | (2S)-3-(1-acetamidoethylsulfanyl)-2,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 154517344 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (2S)-3-(1-acetamidoethylsulfanyl)-2,3-dimethylbutanoic acid |
| SMILES | CC(=O)NC(C)SC(C)(C)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C10H19NO3S/c1-6(9(13)14)10(4,5)15-8(3)11-7(2)12/h6,8H,1-5H3,(H,11,12)(H,13,14)/t6-,8?/m0/s1 |
| InChIKey | YSTYBTGDENOLKV-UUEFVBAFSA-N |
| XLogP | 1.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|