C21H32O4 — CID 154517428
17-acetyl-13-(dihydroxymethyl)-10-methyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 154517428) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is 17-acetyl-13-(dihydroxymethyl)-10-methyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 17-acetyl-13-(dihydroxymethyl)-10-methyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 154517428 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 17-acetyl-13-(dihydroxymethyl)-10-methyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)C1CCC2C3CCC4CC(=O)CCC4(C)C3CCC12C(O)O |
| InChI | InChI=1S/C21H32O4/c1-12(22)16-5-6-18-15-4-3-13-11-14(23)7-9-20(13,2)17(15)8-10-21(16,18)19(24)25/h13,15-19,24-25H,3-11H2,1-2H3 |
| InChIKey | YANFVQUKICPLSA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|