C21H33NO — CID 168883313
17-ethanimidoyl-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 168883313) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is 17-ethanimidoyl-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 17-ethanimidoyl-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 168883313 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | 17-ethanimidoyl-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | [H]/N=C(\C)C1CCC2C3CCC4CC(=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C21H33NO/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h14,16-19,22H,4-12H2,1-3H3/b22-13+ |
| InChIKey | NJQHJUSXMQCAER-LPYMAVHISA-N |
| XLogP | 5.25 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|