C21H31NaO3 — CID 24769388
sodium 2-[(5R,10S,13S,17S)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethanolate (PubChem CID 24769388) has the molecular formula C21H31NaO3 and a molecular weight of 354.47 g/mol. Its IUPAC name is sodium 2-[(5R,10S,13S,17S)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethanolate.
| Compound Name | sodium 2-[(5R,10S,13S,17S)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethanolate |
|---|---|
| PubChem CID | 24769388 |
| Molecular Formula | C21H31NaO3 |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | sodium 2-[(5R,10S,13S,17S)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethanolate |
| SMILES | C[C@]12CCC3C(CC[C@@H]4CC(=O)CC[C@]34C)C1CC[C@@H]2C(=O)C[O-].[Na+] |
| InChI | InChI=1S/C21H31O3.Na/c1-20-9-7-14(23)11-13(20)3-4-15-16-5-6-18(19(24)12-22)21(16,2)10-8-17(15)20;/h13,15-18H,3-12H2,1-2H3;/q-1;+1/t13-,15?,16?,17?,18-,20+,21+;/m1./s1 |
| InChIKey | KXGJGIHIDYFLDH-RZQGZMDDSA-N |
| XLogP | 0.15 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |