C14H26N2O7S2 — CID 154526033
1-[2-(butylsulfonylamino)-4-methylsulfonylbutanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 154526033) has the molecular formula C14H26N2O7S2 and a molecular weight of 398.50 g/mol. Its IUPAC name is 1-[2-(butylsulfonylamino)-4-methylsulfonylbutanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-(butylsulfonylamino)-4-methylsulfonylbutanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 154526033 |
| Molecular Formula | C14H26N2O7S2 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 1-[2-(butylsulfonylamino)-4-methylsulfonylbutanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCCCS(=O)(=O)NC(CCS(C)(=O)=O)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C14H26N2O7S2/c1-3-4-9-25(22,23)15-11(7-10-24(2,20)21)13(17)16-8-5-6-12(16)14(18)19/h11-12,15H,3-10H2,1-2H3,(H,18,19) |
| InChIKey | PLLLHRHKNOJLFP-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |