C15H27NO2 — CID 154544211
2-methylpropyl (2S,3R)-3-cyclohexylpyrrolidine-2-carboxylate (PubChem CID 154544211) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-methylpropyl (2S,3R)-3-cyclohexylpyrrolidine-2-carboxylate.
| Compound Name | 2-methylpropyl (2S,3R)-3-cyclohexylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 154544211 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 2-methylpropyl (2S,3R)-3-cyclohexylpyrrolidine-2-carboxylate |
| SMILES | CC(C)COC(=O)[C@H]1NCC[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C15H27NO2/c1-11(2)10-18-15(17)14-13(8-9-16-14)12-6-4-3-5-7-12/h11-14,16H,3-10H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | BZAUWCTXJQNWTK-KGLIPLIRSA-N |
| XLogP | 2.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |