C15H21F3N2OS — CID 154553551
2,2,2-trifluoro-1-[4-(4-thiophen-2-ylbutylamino)piperidin-1-yl]ethanone (PubChem CID 154553551) has the molecular formula C15H21F3N2OS and a molecular weight of 334.41 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-(4-thiophen-2-ylbutylamino)piperidin-1-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[4-(4-thiophen-2-ylbutylamino)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 154553551 |
| Molecular Formula | C15H21F3N2OS |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-(4-thiophen-2-ylbutylamino)piperidin-1-yl]ethanone |
| SMILES | O=C(N1CCC(NCCCCc2cccs2)CC1)C(F)(F)F |
| InChI | InChI=1S/C15H21F3N2OS/c16-15(17,18)14(21)20-9-6-12(7-10-20)19-8-2-1-4-13-5-3-11-22-13/h3,5,11-12,19H,1-2,4,6-10H2 |
| InChIKey | MOIOEQBZMKKRDC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|