About 1-[6-methoxy-4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]cyclohexa-2,4-dien-1-yl]ethanol
1-[6-methoxy-4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]cyclohexa-2,4-dien-1-yl]ethanol (PubChem CID 154558336) has the molecular formula C17H29NO3
and a molecular weight of 295.42 g/mol. Its IUPAC name is 1-[6-methoxy-4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]cyclohexa-2,4-dien-1-yl]ethanol.
Molecular Properties
| Compound Name | 1-[6-methoxy-4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]cyclohexa-2,4-dien-1-yl]ethanol |
| PubChem CID | 154558336 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 1-[6-methoxy-4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]cyclohexa-2,4-dien-1-yl]ethanol |
| SMILES | COC1C=C(OCCCN2CCC[C@H]2C)C=CC1C(C)O |
| InChI | InChI=1S/C17H29NO3/c1-13-6-4-9-18(13)10-5-11-21-15-7-8-16(14(2)19)17(12-15)20-3/h7-8,12-14,16-17,19H,4-6,9-11H2,1-3H3/t13-,14?,16?,17?/m1/s1 |
| InChIKey | VZILOIHNAPPCKI-WSVPJTFXSA-N |
| XLogP | 2.34 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[6-methoxy-4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]cyclohexa-2,4-dien-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-methoxy-4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]cyclohexa-2,4-dien-1-yl]ethanol?
The IUPAC name of 1-[6-methoxy-4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]cyclohexa-2,4-dien-1-yl]ethanol (CID 154558336) is 1-[6-methoxy-4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]cyclohexa-2,4-dien-1-yl]ethanol.
What is the SMILES notation for 1-[6-methoxy-4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]cyclohexa-2,4-dien-1-yl]ethanol?
The canonical SMILES for 1-[6-methoxy-4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]cyclohexa-2,4-dien-1-yl]ethanol is COC1C=C(OCCCN2CCC[C@H]2C)C=CC1C(C)O.
What is the InChIKey of 1-[6-methoxy-4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]cyclohexa-2,4-dien-1-yl]ethanol?
The InChIKey is VZILOIHNAPPCKI-WSVPJTFXSA-N. The full InChI is InChI=1S/C17H29NO3/c1-13-6-4-9-18(13)10-5-11-21-15-7-8-16(14(2)19)17(12-15)20-3/h7-8,12-14,16-17,19H,4-6,9-11H2,1-3H3/t13-,14?,16?,17?/m1/s1.
What are the key properties of 1-[6-methoxy-4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]cyclohexa-2,4-dien-1-yl]ethanol?
1-[6-methoxy-4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]cyclohexa-2,4-dien-1-yl]ethanol has a molecular weight of 295.42 g/mol, XLogP of 2.34, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-methoxy-4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]cyclohexa-2,4-dien-1-yl]ethanol is sourced from PubChem (CID 154558336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).