C18H31NO2 — CID 123749955
4-ethylidene-7-methyl-6-propoxy-1-pyrrolidin-1-ylocta-5,7-dien-3-ol (PubChem CID 123749955) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is 4-ethylidene-7-methyl-6-propoxy-1-pyrrolidin-1-ylocta-5,7-dien-3-ol.
| Compound Name | 4-ethylidene-7-methyl-6-propoxy-1-pyrrolidin-1-ylocta-5,7-dien-3-ol |
|---|---|
| PubChem CID | 123749955 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | 4-ethylidene-7-methyl-6-propoxy-1-pyrrolidin-1-ylocta-5,7-dien-3-ol |
| SMILES | C=C(C)C(=CC(=CC)C(O)CCN1CCCC1)OCCC |
| InChI | InChI=1S/C18H31NO2/c1-5-13-21-18(15(3)4)14-16(6-2)17(20)9-12-19-10-7-8-11-19/h6,14,17,20H,3,5,7-13H2,1-2,4H3 |
| InChIKey | XBAMUDDPDBHXRA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|