C14H22FNO2 — CID 144811357
(4Z)-4-(1-fluoroethenyl)-6-methoxy-1-pyrrolidin-1-ylhepta-4,6-dien-3-ol (PubChem CID 144811357) has the molecular formula C14H22FNO2 and a molecular weight of 255.33 g/mol. Its IUPAC name is (4Z)-4-(1-fluoroethenyl)-6-methoxy-1-pyrrolidin-1-ylhepta-4,6-dien-3-ol.
| Compound Name | (4Z)-4-(1-fluoroethenyl)-6-methoxy-1-pyrrolidin-1-ylhepta-4,6-dien-3-ol |
|---|---|
| PubChem CID | 144811357 |
| Molecular Formula | C14H22FNO2 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (4Z)-4-(1-fluoroethenyl)-6-methoxy-1-pyrrolidin-1-ylhepta-4,6-dien-3-ol |
| SMILES | C=C(/C=C(\C(=C)F)C(O)CCN1CCCC1)OC |
| InChI | InChI=1S/C14H22FNO2/c1-11(18-3)10-13(12(2)15)14(17)6-9-16-7-4-5-8-16/h10,14,17H,1-2,4-9H2,3H3/b13-10+ |
| InChIKey | HCZKQWJLUWNTLL-JLHYYAGUSA-N |
| XLogP | 2.40 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|