C15H25NO — CID 123772804
4-ethylidene-7-methyl-1-pyrrolidin-1-ylocta-5,7-dien-3-ol (PubChem CID 123772804) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 4-ethylidene-7-methyl-1-pyrrolidin-1-ylocta-5,7-dien-3-ol.
| Compound Name | 4-ethylidene-7-methyl-1-pyrrolidin-1-ylocta-5,7-dien-3-ol |
|---|---|
| PubChem CID | 123772804 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 4-ethylidene-7-methyl-1-pyrrolidin-1-ylocta-5,7-dien-3-ol |
| SMILES | C=C(C)C=CC(=CC)C(O)CCN1CCCC1 |
| InChI | InChI=1S/C15H25NO/c1-4-14(8-7-13(2)3)15(17)9-12-16-10-5-6-11-16/h4,7-8,15,17H,2,5-6,9-12H2,1,3H3 |
| InChIKey | ROGXQGOJLBCGCK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|