C10H16NO- — CID 123481407
4-ethyl-1-methanidyl-3-[(Z)-prop-1-enyl]-2,5-dihydropyrrol-2-ol (PubChem CID 123481407) has the molecular formula C10H16NO- and a molecular weight of 166.24 g/mol. Its IUPAC name is 4-ethyl-1-methanidyl-3-[(Z)-prop-1-enyl]-2,5-dihydropyrrol-2-ol.
| Compound Name | 4-ethyl-1-methanidyl-3-[(Z)-prop-1-enyl]-2,5-dihydropyrrol-2-ol |
|---|---|
| PubChem CID | 123481407 |
| Molecular Formula | C10H16NO- |
| Molecular Weight | 166.24 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 4-ethyl-1-methanidyl-3-[(Z)-prop-1-enyl]-2,5-dihydropyrrol-2-ol |
| SMILES | [CH2-]N1CC(CC)=C(/C=C\C)C1O |
| InChI | InChI=1S/C10H16NO/c1-4-6-9-8(5-2)7-11(3)10(9)12/h4,6,10,12H,3,5,7H2,1-2H3/q-1/b6-4- |
| InChIKey | ASJJJYOAFTYNNI-XQRVVYSFSA-N |
| XLogP | 1.69 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.24 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|