C17H28ClNO2 — CID 144840065
(4E,5Z,7Z)-8-chloro-4-ethylidene-7-propoxy-1-pyrrolidin-1-ylocta-5,7-dien-3-ol (PubChem CID 144840065) has the molecular formula C17H28ClNO2 and a molecular weight of 313.87 g/mol. Its IUPAC name is (4E,5Z,7Z)-8-chloro-4-ethylidene-7-propoxy-1-pyrrolidin-1-ylocta-5,7-dien-3-ol.
| Compound Name | (4E,5Z,7Z)-8-chloro-4-ethylidene-7-propoxy-1-pyrrolidin-1-ylocta-5,7-dien-3-ol |
|---|---|
| PubChem CID | 144840065 |
| Molecular Formula | C17H28ClNO2 |
| Molecular Weight | 313.87 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | (4E,5Z,7Z)-8-chloro-4-ethylidene-7-propoxy-1-pyrrolidin-1-ylocta-5,7-dien-3-ol |
| SMILES | C/C=C(\C=C/C(=C/Cl)OCCC)C(O)CCN1CCCC1 |
| InChI | InChI=1S/C17H28ClNO2/c1-3-13-21-16(14-18)8-7-15(4-2)17(20)9-12-19-10-5-6-11-19/h4,7-8,14,17,20H,3,5-6,9-13H2,1-2H3/b8-7-,15-4+,16-14- |
| InChIKey | GOYYXRVEFHBBQV-RSAMTLHPSA-N |
| XLogP | 3.84 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.87 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|