C15H23NO3S — CID 82074130
propyl 5-(1-hydroxy-3-pyrrolidin-1-ylpropyl)thiophene-2-carboxylate (PubChem CID 82074130) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is propyl 5-(1-hydroxy-3-pyrrolidin-1-ylpropyl)thiophene-2-carboxylate.
| Compound Name | propyl 5-(1-hydroxy-3-pyrrolidin-1-ylpropyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 82074130 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | propyl 5-(1-hydroxy-3-pyrrolidin-1-ylpropyl)thiophene-2-carboxylate |
| SMILES | CCCOC(=O)c1ccc(C(O)CCN2CCCC2)s1 |
| InChI | InChI=1S/C15H23NO3S/c1-2-11-19-15(18)14-6-5-13(20-14)12(17)7-10-16-8-3-4-9-16/h5-6,12,17H,2-4,7-11H2,1H3 |
| InChIKey | VTRVIRVCLXFFGW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |