About (1S)-1-(4-ethoxybenzene-5-id-1-yl)-3-pyrrolidin-1-ylpropan-1-ol;uranium(2+)
(1S)-1-(4-ethoxybenzene-5-id-1-yl)-3-pyrrolidin-1-ylpropan-1-ol;uranium(2+) (PubChem CID 153357481) has the molecular formula C15H21NO2U
and a molecular weight of 485.37 g/mol. Its IUPAC name is (1S)-1-(4-ethoxybenzene-5-id-1-yl)-3-pyrrolidin-1-ylpropan-1-ol;uranium(2+).
Molecular Properties
| Compound Name | (1S)-1-(4-ethoxybenzene-5-id-1-yl)-3-pyrrolidin-1-ylpropan-1-ol;uranium(2+) |
| PubChem CID | 153357481 |
| Molecular Formula | C15H21NO2U |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | (1S)-1-(4-ethoxybenzene-5-id-1-yl)-3-pyrrolidin-1-ylpropan-1-ol;uranium(2+) |
| SMILES | [CH2-]COc1[c-]cc([C@@H](O)CCN2CCCC2)cc1.[U+2] |
| InChI | InChI=1S/C15H21NO2.U/c1-2-18-14-7-5-13(6-8-14)15(17)9-12-16-10-3-4-11-16;/h5-7,15,17H,1-4,9-12H2;/q-2;+2/t15-;/m0./s1 |
| InChIKey | ZPEDFRKVBBPQHM-RSAXXLAASA-N |
| XLogP | 2.22 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-(4-ethoxybenzene-5-id-1-yl)-3-pyrrolidin-1-ylpropan-1-ol;uranium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(4-ethoxybenzene-5-id-1-yl)-3-pyrrolidin-1-ylpropan-1-ol;uranium(2+)?
The IUPAC name of (1S)-1-(4-ethoxybenzene-5-id-1-yl)-3-pyrrolidin-1-ylpropan-1-ol;uranium(2+) (CID 153357481) is (1S)-1-(4-ethoxybenzene-5-id-1-yl)-3-pyrrolidin-1-ylpropan-1-ol;uranium(2+).
What is the SMILES notation for (1S)-1-(4-ethoxybenzene-5-id-1-yl)-3-pyrrolidin-1-ylpropan-1-ol;uranium(2+)?
The canonical SMILES for (1S)-1-(4-ethoxybenzene-5-id-1-yl)-3-pyrrolidin-1-ylpropan-1-ol;uranium(2+) is [CH2-]COc1[c-]cc([C@@H](O)CCN2CCCC2)cc1.[U+2].
What is the InChIKey of (1S)-1-(4-ethoxybenzene-5-id-1-yl)-3-pyrrolidin-1-ylpropan-1-ol;uranium(2+)?
The InChIKey is ZPEDFRKVBBPQHM-RSAXXLAASA-N. The full InChI is InChI=1S/C15H21NO2.U/c1-2-18-14-7-5-13(6-8-14)15(17)9-12-16-10-3-4-11-16;/h5-7,15,17H,1-4,9-12H2;/q-2;+2/t15-;/m0./s1.
What are the key properties of (1S)-1-(4-ethoxybenzene-5-id-1-yl)-3-pyrrolidin-1-ylpropan-1-ol;uranium(2+)?
(1S)-1-(4-ethoxybenzene-5-id-1-yl)-3-pyrrolidin-1-ylpropan-1-ol;uranium(2+) has a molecular weight of 485.37 g/mol, XLogP of 2.22, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(4-ethoxybenzene-5-id-1-yl)-3-pyrrolidin-1-ylpropan-1-ol;uranium(2+) is sourced from PubChem (CID 153357481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).