C13H13IN2O — CID 154558823
1-N-iodo-2-methoxy-4-N-phenylbenzene-1,4-diamine (PubChem CID 154558823) has the molecular formula C13H13IN2O and a molecular weight of 340.16 g/mol. Its IUPAC name is 1-N-iodo-2-methoxy-4-N-phenylbenzene-1,4-diamine.
| Compound Name | 1-N-iodo-2-methoxy-4-N-phenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 154558823 |
| Molecular Formula | C13H13IN2O |
| Molecular Weight | 340.16 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 1-N-iodo-2-methoxy-4-N-phenylbenzene-1,4-diamine |
| SMILES | COc1cc(Nc2ccccc2)ccc1NI |
| InChI | InChI=1S/C13H13IN2O/c1-17-13-9-11(7-8-12(13)16-14)15-10-5-3-2-4-6-10/h2-9,15-16H,1H3 |
| InChIKey | KBXGKBCOTLURGD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.16 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|