About 3-methoxy-4-methyl-N-phenylaniline;oxido sulfite
3-methoxy-4-methyl-N-phenylaniline;oxido sulfite (PubChem CID 91481114) has the molecular formula C14H15NO5S-2
and a molecular weight of 309.34 g/mol. Its IUPAC name is 3-methoxy-4-methyl-N-phenylaniline;oxido sulfite.
Molecular Properties
| Compound Name | 3-methoxy-4-methyl-N-phenylaniline;oxido sulfite |
| PubChem CID | 91481114 |
| Molecular Formula | C14H15NO5S-2 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 3-methoxy-4-methyl-N-phenylaniline;oxido sulfite |
| SMILES | COc1cc(Nc2ccccc2)ccc1C.O=S([O-])O[O-] |
| InChI | InChI=1S/C14H15NO.H2O4S/c1-11-8-9-13(10-14(11)16-2)15-12-6-4-3-5-7-12;1-4-5(2)3/h3-10,15H,1-2H3;1H,(H,2,3)/p-2 |
| InChIKey | YRLNRZPPNHRPDM-UHFFFAOYSA-L |
| XLogP | 1.82 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-4-methyl-N-phenylaniline;oxido sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-4-methyl-N-phenylaniline;oxido sulfite?
The IUPAC name of 3-methoxy-4-methyl-N-phenylaniline;oxido sulfite (CID 91481114) is 3-methoxy-4-methyl-N-phenylaniline;oxido sulfite.
What is the SMILES notation for 3-methoxy-4-methyl-N-phenylaniline;oxido sulfite?
The canonical SMILES for 3-methoxy-4-methyl-N-phenylaniline;oxido sulfite is COc1cc(Nc2ccccc2)ccc1C.O=S([O-])O[O-].
What is the InChIKey of 3-methoxy-4-methyl-N-phenylaniline;oxido sulfite?
The InChIKey is YRLNRZPPNHRPDM-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H15NO.H2O4S/c1-11-8-9-13(10-14(11)16-2)15-12-6-4-3-5-7-12;1-4-5(2)3/h3-10,15H,1-2H3;1H,(H,2,3)/p-2.
What are the key properties of 3-methoxy-4-methyl-N-phenylaniline;oxido sulfite?
3-methoxy-4-methyl-N-phenylaniline;oxido sulfite has a molecular weight of 309.34 g/mol, XLogP of 1.82, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-4-methyl-N-phenylaniline;oxido sulfite is sourced from PubChem (CID 91481114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).