C11H22N3O3P — CID 15456
ethyl N-bis(2,2-dimethylaziridin-1-yl)phosphorylcarbamate (PubChem CID 15456) has the molecular formula C11H22N3O3P and a molecular weight of 275.29 g/mol. Its IUPAC name is ethyl N-bis(2,2-dimethylaziridin-1-yl)phosphorylcarbamate.
| Compound Name | ethyl N-bis(2,2-dimethylaziridin-1-yl)phosphorylcarbamate |
|---|---|
| PubChem CID | 15456 |
| Molecular Formula | C11H22N3O3P |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | ethyl N-bis(2,2-dimethylaziridin-1-yl)phosphorylcarbamate |
| SMILES | CCOC(=O)NP(=O)(N1CC1(C)C)N1CC1(C)C |
| InChI | InChI=1S/C11H22N3O3P/c1-6-17-9(15)12-18(16,13-7-10(13,2)3)14-8-11(14,4)5/h6-8H2,1-5H3,(H,12,15,16) |
| InChIKey | QTFKTBRIGWJQQL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 61.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|