C15H15N7O2 — CID 154563824
2-[3-pyridin-2-yl-5-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-1,2,4-triazol-1-yl]acetic acid (PubChem CID 154563824) has the molecular formula C15H15N7O2 and a molecular weight of 325.33 g/mol. Its IUPAC name is 2-[3-pyridin-2-yl-5-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-1,2,4-triazol-1-yl]acetic acid.
| Compound Name | 2-[3-pyridin-2-yl-5-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-1,2,4-triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 154563824 |
| Molecular Formula | C15H15N7O2 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-[3-pyridin-2-yl-5-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)-1,2,4-triazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1nc(-c2ccccn2)nc1C1CCn2ncnc2C1 |
| InChI | InChI=1S/C15H15N7O2/c23-13(24)8-22-15(10-4-6-21-12(7-10)17-9-18-21)19-14(20-22)11-3-1-2-5-16-11/h1-3,5,9-10H,4,6-8H2,(H,23,24) |
| InChIKey | KIXCLCKXLOHCJB-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |