C17H20N6O — CID 154818806
7-[2-[(2-methoxyphenyl)methyl]-5-methyl-1,2,4-triazol-3-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 154818806) has the molecular formula C17H20N6O and a molecular weight of 324.39 g/mol. Its IUPAC name is 7-[2-[(2-methoxyphenyl)methyl]-5-methyl-1,2,4-triazol-3-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 7-[2-[(2-methoxyphenyl)methyl]-5-methyl-1,2,4-triazol-3-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 154818806 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 7-[2-[(2-methoxyphenyl)methyl]-5-methyl-1,2,4-triazol-3-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COc1ccccc1Cn1nc(C)nc1C1CCn2ncnc2C1 |
| InChI | InChI=1S/C17H20N6O/c1-12-20-17(13-7-8-22-16(9-13)18-11-19-22)23(21-12)10-14-5-3-4-6-15(14)24-2/h3-6,11,13H,7-10H2,1-2H3 |
| InChIKey | IDBHDEOJSKWDFM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |