C20H25N3O4 — CID 154564046
(5aS,8aS)-7-(5-methoxy-1,2-dimethylindole-3-carbonyl)-5-methyl-2,3,5a,6,8,8a-hexahydropyrrolo[3,4-b][1,4]oxazepin-4-one (PubChem CID 154564046) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is (5aS,8aS)-7-(5-methoxy-1,2-dimethylindole-3-carbonyl)-5-methyl-2,3,5a,6,8,8a-hexahydropyrrolo[3,4-b][1,4]oxazepin-4-one.
| Compound Name | (5aS,8aS)-7-(5-methoxy-1,2-dimethylindole-3-carbonyl)-5-methyl-2,3,5a,6,8,8a-hexahydropyrrolo[3,4-b][1,4]oxazepin-4-one |
|---|---|
| PubChem CID | 154564046 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | (5aS,8aS)-7-(5-methoxy-1,2-dimethylindole-3-carbonyl)-5-methyl-2,3,5a,6,8,8a-hexahydropyrrolo[3,4-b][1,4]oxazepin-4-one |
| SMILES | COc1ccc2c(c1)c(C(=O)N1C[C@@H]3OCCC(=O)N(C)[C@H]3C1)c(C)n2C |
| InChI | InChI=1S/C20H25N3O4/c1-12-19(14-9-13(26-4)5-6-15(14)21(12)2)20(25)23-10-16-17(11-23)27-8-7-18(24)22(16)3/h5-6,9,16-17H,7-8,10-11H2,1-4H3/t16-,17-/m0/s1 |
| InChIKey | WSPXUGLXTALBMF-IRXDYDNUSA-N |
| XLogP | 1.57 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |