C17H22N2O4 — CID 91791830
N-[(3R,4R)-4-hydroxyoxan-3-yl]-5-methoxy-1,2-dimethylindole-3-carboxamide (PubChem CID 91791830) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is N-[(3R,4R)-4-hydroxyoxan-3-yl]-5-methoxy-1,2-dimethylindole-3-carboxamide.
| Compound Name | N-[(3R,4R)-4-hydroxyoxan-3-yl]-5-methoxy-1,2-dimethylindole-3-carboxamide |
|---|---|
| PubChem CID | 91791830 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | N-[(3R,4R)-4-hydroxyoxan-3-yl]-5-methoxy-1,2-dimethylindole-3-carboxamide |
| SMILES | COc1ccc2c(c1)c(C(=O)N[C@@H]1COCC[C@H]1O)c(C)n2C |
| InChI | InChI=1S/C17H22N2O4/c1-10-16(17(21)18-13-9-23-7-6-15(13)20)12-8-11(22-3)4-5-14(12)19(10)2/h4-5,8,13,15,20H,6-7,9H2,1-3H3,(H,18,21)/t13-,15-/m1/s1 |
| InChIKey | GEFOQAFRGUAIRR-UKRRQHHQSA-N |
| XLogP | 1.37 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |