C22H34N4O2 — CID 154569085
4-[2-[2-[2-(4-ethylpiperazin-1-yl)ethoxy]phenyl]imidazol-1-yl]-2-methylbutan-2-ol (PubChem CID 154569085) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 4-[2-[2-[2-(4-ethylpiperazin-1-yl)ethoxy]phenyl]imidazol-1-yl]-2-methylbutan-2-ol.
| Compound Name | 4-[2-[2-[2-(4-ethylpiperazin-1-yl)ethoxy]phenyl]imidazol-1-yl]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 154569085 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | 4-[2-[2-[2-(4-ethylpiperazin-1-yl)ethoxy]phenyl]imidazol-1-yl]-2-methylbutan-2-ol |
| SMILES | CCN1CCN(CCOc2ccccc2-c2nccn2CCC(C)(C)O)CC1 |
| InChI | InChI=1S/C22H34N4O2/c1-4-24-13-15-25(16-14-24)17-18-28-20-8-6-5-7-19(20)21-23-10-12-26(21)11-9-22(2,3)27/h5-8,10,12,27H,4,9,11,13-18H2,1-3H3 |
| InChIKey | YQFDKCUTYZMKAP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 53.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |