C20H28N4 — CID 154569415
trans-(1S,3S)-3-[(3-phenyl-4,5,7,8-tetrahydro-1H-pyrazolo[4,5-d]azepin-6-yl)methyl]cyclohexan-1-amine (PubChem CID 154569415) has the molecular formula C20H28N4 and a molecular weight of 324.47 g/mol. Its IUPAC name is trans-(1S,3S)-3-[(3-phenyl-4,5,7,8-tetrahydro-1H-pyrazolo[4,5-d]azepin-6-yl)methyl]cyclohexan-1-amine.
| Compound Name | trans-(1S,3S)-3-[(3-phenyl-4,5,7,8-tetrahydro-1H-pyrazolo[4,5-d]azepin-6-yl)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 154569415 |
| Molecular Formula | C20H28N4 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | trans-(1S,3S)-3-[(3-phenyl-4,5,7,8-tetrahydro-1H-pyrazolo[4,5-d]azepin-6-yl)methyl]cyclohexan-1-amine |
| SMILES | N[C@H]1CCC[C@H](CN2CCc3[nH]nc(-c4ccccc4)c3CC2)C1 |
| InChI | InChI=1S/C20H28N4/c21-17-8-4-5-15(13-17)14-24-11-9-18-19(10-12-24)22-23-20(18)16-6-2-1-3-7-16/h1-3,6-7,15,17H,4-5,8-14,21H2,(H,22,23)/t15-,17-/m0/s1 |
| InChIKey | CWRHBCZMTYVAEO-RDJZCZTQSA-N |
| XLogP | 2.99 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |