C19H24N4O2 — CID 154821382
[(1S,3S,4S)-3-amino-4-hydroxycyclopentyl]-(3-phenyl-4,5,7,8-tetrahydro-1H-pyrazolo[4,5-d]azepin-6-yl)methanone (PubChem CID 154821382) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is [(1S,3S,4S)-3-amino-4-hydroxycyclopentyl]-(3-phenyl-4,5,7,8-tetrahydro-1H-pyrazolo[4,5-d]azepin-6-yl)methanone.
| Compound Name | [(1S,3S,4S)-3-amino-4-hydroxycyclopentyl]-(3-phenyl-4,5,7,8-tetrahydro-1H-pyrazolo[4,5-d]azepin-6-yl)methanone |
|---|---|
| PubChem CID | 154821382 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | [(1S,3S,4S)-3-amino-4-hydroxycyclopentyl]-(3-phenyl-4,5,7,8-tetrahydro-1H-pyrazolo[4,5-d]azepin-6-yl)methanone |
| SMILES | N[C@H]1C[C@H](C(=O)N2CCc3[nH]nc(-c4ccccc4)c3CC2)C[C@@H]1O |
| InChI | InChI=1S/C19H24N4O2/c20-15-10-13(11-17(15)24)19(25)23-8-6-14-16(7-9-23)21-22-18(14)12-4-2-1-3-5-12/h1-5,13,15,17,24H,6-11,20H2,(H,21,22)/t13-,15-,17-/m0/s1 |
| InChIKey | BXAGZYDLTSEMRF-QRTARXTBSA-N |
| XLogP | 1.10 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |