C19H27N3O2 — CID 154569705
6-[2-(2-methoxyethoxy)ethyl]-1-methyl-3-phenyl-4,5,7,8-tetrahydropyrazolo[4,5-d]azepine (PubChem CID 154569705) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 6-[2-(2-methoxyethoxy)ethyl]-1-methyl-3-phenyl-4,5,7,8-tetrahydropyrazolo[4,5-d]azepine.
| Compound Name | 6-[2-(2-methoxyethoxy)ethyl]-1-methyl-3-phenyl-4,5,7,8-tetrahydropyrazolo[4,5-d]azepine |
|---|---|
| PubChem CID | 154569705 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 6-[2-(2-methoxyethoxy)ethyl]-1-methyl-3-phenyl-4,5,7,8-tetrahydropyrazolo[4,5-d]azepine |
| SMILES | COCCOCCN1CCc2c(-c3ccccc3)nn(C)c2CC1 |
| InChI | InChI=1S/C19H27N3O2/c1-21-18-9-11-22(12-13-24-15-14-23-2)10-8-17(18)19(20-21)16-6-4-3-5-7-16/h3-7H,8-15H2,1-2H3 |
| InChIKey | XJILWXPTNAETCV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|