C20H22ClN3O3 — CID 163334343
6-[(5-chlorofuran-2-yl)methyl]-1-methyl-3-phenyl-4,5,7,8-tetrahydropyrazolo[4,5-d]azepine;formic acid (PubChem CID 163334343) has the molecular formula C20H22ClN3O3 and a molecular weight of 387.87 g/mol. Its IUPAC name is 6-[(5-chlorofuran-2-yl)methyl]-1-methyl-3-phenyl-4,5,7,8-tetrahydropyrazolo[4,5-d]azepine;formic acid.
| Compound Name | 6-[(5-chlorofuran-2-yl)methyl]-1-methyl-3-phenyl-4,5,7,8-tetrahydropyrazolo[4,5-d]azepine;formic acid |
|---|---|
| PubChem CID | 163334343 |
| Molecular Formula | C20H22ClN3O3 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 6-[(5-chlorofuran-2-yl)methyl]-1-methyl-3-phenyl-4,5,7,8-tetrahydropyrazolo[4,5-d]azepine;formic acid |
| SMILES | Cn1nc(-c2ccccc2)c2c1CCN(Cc1ccc(Cl)o1)CC2.O=CO |
| InChI | InChI=1S/C19H20ClN3O.CH2O2/c1-22-17-10-12-23(13-15-7-8-18(20)24-15)11-9-16(17)19(21-22)14-5-3-2-4-6-14;2-1-3/h2-8H,9-13H2,1H3;1H,(H,2,3) |
| InChIKey | UKELOTNDXYADAK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|