C28H39N3O3 — CID 154570617
4-[3-(16-oxa-9,12-diazatricyclo[15.3.1.04,9]henicosa-1(21),17,19-trien-12-yl)propoxy]benzamide (PubChem CID 154570617) has the molecular formula C28H39N3O3 and a molecular weight of 465.64 g/mol. Its IUPAC name is 4-[3-(16-oxa-9,12-diazatricyclo[15.3.1.04,9]henicosa-1(21),17,19-trien-12-yl)propoxy]benzamide.
| Compound Name | 4-[3-(16-oxa-9,12-diazatricyclo[15.3.1.04,9]henicosa-1(21),17,19-trien-12-yl)propoxy]benzamide |
|---|---|
| PubChem CID | 154570617 |
| Molecular Formula | C28H39N3O3 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | 4-[3-(16-oxa-9,12-diazatricyclo[15.3.1.04,9]henicosa-1(21),17,19-trien-12-yl)propoxy]benzamide |
| SMILES | NC(=O)c1ccc(OCCCN2CCCOc3cccc(c3)CCC3CCCCN3CC2)cc1 |
| InChI | InChI=1S/C28H39N3O3/c29-28(32)24-10-13-26(14-11-24)33-20-4-15-30-16-5-21-34-27-8-3-6-23(22-27)9-12-25-7-1-2-17-31(25)19-18-30/h3,6,8,10-11,13-14,22,25H,1-2,4-5,7,9,12,15-21H2,(H2,29,32) |
| InChIKey | ADDLNQWMZMUQQY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|