C21H21ClFN3O2 — CID 154571233
3-[[2-[2-[(2-chloro-6-fluorophenyl)methoxy]phenyl]imidazol-1-yl]methyl]pyrrolidin-3-ol (PubChem CID 154571233) has the molecular formula C21H21ClFN3O2 and a molecular weight of 401.87 g/mol. Its IUPAC name is 3-[[2-[2-[(2-chloro-6-fluorophenyl)methoxy]phenyl]imidazol-1-yl]methyl]pyrrolidin-3-ol.
| Compound Name | 3-[[2-[2-[(2-chloro-6-fluorophenyl)methoxy]phenyl]imidazol-1-yl]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 154571233 |
| Molecular Formula | C21H21ClFN3O2 |
| Molecular Weight | 401.87 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 3-[[2-[2-[(2-chloro-6-fluorophenyl)methoxy]phenyl]imidazol-1-yl]methyl]pyrrolidin-3-ol |
| SMILES | OC1(Cn2ccnc2-c2ccccc2OCc2c(F)cccc2Cl)CCNC1 |
| InChI | InChI=1S/C21H21ClFN3O2/c22-17-5-3-6-18(23)16(17)12-28-19-7-2-1-4-15(19)20-25-10-11-26(20)14-21(27)8-9-24-13-21/h1-7,10-11,24,27H,8-9,12-14H2 |
| InChIKey | RULDOIGCATWASC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.87 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |