C22H26Cl3FN2O — CID 154909138
(1R,2S,6R,7S)-10-[[2-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methyl]-4,10-diazatricyclo[5.2.1.02,6]decane;dihydrochloride (PubChem CID 154909138) has the molecular formula C22H26Cl3FN2O and a molecular weight of 459.82 g/mol. Its IUPAC name is (1R,2S,6R,7S)-10-[[2-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methyl]-4,10-diazatricyclo[5.2.1.02,6]decane;dihydrochloride.
| Compound Name | (1R,2S,6R,7S)-10-[[2-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methyl]-4,10-diazatricyclo[5.2.1.02,6]decane;dihydrochloride |
|---|---|
| PubChem CID | 154909138 |
| Molecular Formula | C22H26Cl3FN2O |
| Molecular Weight | 459.82 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | (1R,2S,6R,7S)-10-[[2-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methyl]-4,10-diazatricyclo[5.2.1.02,6]decane;dihydrochloride |
| SMILES | Cl.Cl.Fc1cccc(Cl)c1COc1ccccc1CN1[C@@H]2CC[C@H]1[C@H]1CNC[C@H]12 |
| InChI | InChI=1S/C22H24ClFN2O.2ClH/c23-18-5-3-6-19(24)17(18)13-27-22-7-2-1-4-14(22)12-26-20-8-9-21(26)16-11-25-10-15(16)20;;/h1-7,15-16,20-21,25H,8-13H2;2*1H/t15-,16+,20-,21+;; |
| InChIKey | SDXJMFSEGITPGH-CDHQJFQDSA-N |
| XLogP | 5.08 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.82 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |