C24H25ClFNO — CID 51990859
(2R)-N-[[2-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methyl]-4-phenylbutan-2-amine (PubChem CID 51990859) has the molecular formula C24H25ClFNO and a molecular weight of 397.92 g/mol. Its IUPAC name is (2R)-N-[[2-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methyl]-4-phenylbutan-2-amine.
| Compound Name | (2R)-N-[[2-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methyl]-4-phenylbutan-2-amine |
|---|---|
| PubChem CID | 51990859 |
| Molecular Formula | C24H25ClFNO |
| Molecular Weight | 397.92 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | (2R)-N-[[2-[(2-chloro-6-fluorophenyl)methoxy]phenyl]methyl]-4-phenylbutan-2-amine |
| SMILES | C[C@H](CCc1ccccc1)NCc1ccccc1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C24H25ClFNO/c1-18(14-15-19-8-3-2-4-9-19)27-16-20-10-5-6-13-24(20)28-17-21-22(25)11-7-12-23(21)26/h2-13,18,27H,14-17H2,1H3/t18-/m1/s1 |
| InChIKey | DWLWJYOVNPKXQV-GOSISDBHSA-N |
| XLogP | 6.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.92 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |