C21H25N5O3 — CID 154571590
5,5-dimethyl-3-[2-(1-methyl-3-phenyl-4,5,7,8-tetrahydropyrazolo[4,5-d]azepin-6-yl)-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 154571590) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 5,5-dimethyl-3-[2-(1-methyl-3-phenyl-4,5,7,8-tetrahydropyrazolo[4,5-d]azepin-6-yl)-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[2-(1-methyl-3-phenyl-4,5,7,8-tetrahydropyrazolo[4,5-d]azepin-6-yl)-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 154571590 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 5,5-dimethyl-3-[2-(1-methyl-3-phenyl-4,5,7,8-tetrahydropyrazolo[4,5-d]azepin-6-yl)-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | Cn1nc(-c2ccccc2)c2c1CCN(C(=O)CN1C(=O)NC(C)(C)C1=O)CC2 |
| InChI | InChI=1S/C21H25N5O3/c1-21(2)19(28)26(20(29)22-21)13-17(27)25-11-9-15-16(10-12-25)24(3)23-18(15)14-7-5-4-6-8-14/h4-8H,9-13H2,1-3H3,(H,22,29) |
| InChIKey | APSCODPDUBBRAA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|