C19H23N3O — CID 154571885
(1S,3aS,6aS)-N-[(4-pyrazol-1-ylphenyl)methyl]-1,2,3,3a,4,5,6,6a-octahydropentalene-1-carboxamide (PubChem CID 154571885) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is (1S,3aS,6aS)-N-[(4-pyrazol-1-ylphenyl)methyl]-1,2,3,3a,4,5,6,6a-octahydropentalene-1-carboxamide.
| Compound Name | (1S,3aS,6aS)-N-[(4-pyrazol-1-ylphenyl)methyl]-1,2,3,3a,4,5,6,6a-octahydropentalene-1-carboxamide |
|---|---|
| PubChem CID | 154571885 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | (1S,3aS,6aS)-N-[(4-pyrazol-1-ylphenyl)methyl]-1,2,3,3a,4,5,6,6a-octahydropentalene-1-carboxamide |
| SMILES | O=C(NCc1ccc(-n2cccn2)cc1)[C@H]1CC[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C19H23N3O/c23-19(18-10-7-15-3-1-4-17(15)18)20-13-14-5-8-16(9-6-14)22-12-2-11-21-22/h2,5-6,8-9,11-12,15,17-18H,1,3-4,7,10,13H2,(H,20,23)/t15-,17-,18-/m0/s1 |
| InChIKey | MOLXNTCYLVFTOT-SZMVWBNQSA-N |
| XLogP | 3.31 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |