C23H25N5O2 — CID 55711481
1-N-phenyl-3-N-[(4-pyrazol-1-ylphenyl)methyl]piperidine-1,3-dicarboxamide (PubChem CID 55711481) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 1-N-phenyl-3-N-[(4-pyrazol-1-ylphenyl)methyl]piperidine-1,3-dicarboxamide.
| Compound Name | 1-N-phenyl-3-N-[(4-pyrazol-1-ylphenyl)methyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 55711481 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 1-N-phenyl-3-N-[(4-pyrazol-1-ylphenyl)methyl]piperidine-1,3-dicarboxamide |
| SMILES | O=C(NCc1ccc(-n2cccn2)cc1)C1CCCN(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C23H25N5O2/c29-22(24-16-18-9-11-21(12-10-18)28-15-5-13-25-28)19-6-4-14-27(17-19)23(30)26-20-7-2-1-3-8-20/h1-3,5,7-13,15,19H,4,6,14,16-17H2,(H,24,29)(H,26,30) |
| InChIKey | HEAWOFCRZQFWSN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |