C55H84NO10P — CID 154573170
(2S)-2-amino-3-[hydroxy-[(2R)-3-pentacosa-3,6,9,12,15,18-hexaenoyloxy-2-tetracosa-3,6,9,12,15,18-hexaenoyloxypropoxy]phosphoryl]oxypropanoic acid (PubChem CID 154573170) has the molecular formula C55H84NO10P and a molecular weight of 950.25 g/mol. Its IUPAC name is (2S)-2-amino-3-[hydroxy-[(2R)-3-pentacosa-3,6,9,12,15,18-hexaenoyloxy-2-tetracosa-3,6,9,12,15,18-hexaenoyloxypropoxy]phosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[hydroxy-[(2R)-3-pentacosa-3,6,9,12,15,18-hexaenoyloxy-2-tetracosa-3,6,9,12,15,18-hexaenoyloxypropoxy]phosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 154573170 |
| Molecular Formula | C55H84NO10P |
| Molecular Weight | 950.25 g/mol |
| Exact Mass | 949.58 |
| IUPAC Name | (2S)-2-amino-3-[hydroxy-[(2R)-3-pentacosa-3,6,9,12,15,18-hexaenoyloxy-2-tetracosa-3,6,9,12,15,18-hexaenoyloxypropoxy]phosphoryl]oxypropanoic acid |
| SMILES | CCCCCC=CCC=CCC=CCC=CCC=CCC=CCC(=O)O[C@H](COC(=O)CC=CCC=CCC=CCC=CCC=CCC=CCCCCCC)COP(=O)(O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C55H84NO10P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-28-30-32-34-36-38-40-42-44-46-53(57)63-48-51(49-64-67(61,62)65-50-52(56)55(59)60)66-54(58)47-45-43-41-39-37-35-33-31-29-26-24-22-20-18-16-14-12-10-8-6-4-2/h12-15,18-21,24-27,30-33,36-39,42-45,51-52H,3-11,16-17,22-23,28-29,34-35,40-41,46-50,56H2,1-2H3,(H,59,60)(H,61,62)/t51-,52+/m1/s1 |
| InChIKey | BXSXBZZTCXRIND-CECLPTFUSA-N |
| XLogP | 13.89 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 950.25 |
| LogP ≤ 5 | 13.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|