C35H62NO10P — CID 134719693
(2R)-2-amino-3-[hydroxy-[(2S)-3-[(6E,9E,12E)-octadeca-6,9,12-trienoyl]oxy-2-undecanoyloxypropoxy]phosphoryl]oxypropanoic acid (PubChem CID 134719693) has the molecular formula C35H62NO10P and a molecular weight of 687.85 g/mol. Its IUPAC name is (2R)-2-amino-3-[hydroxy-[(2S)-3-[(6E,9E,12E)-octadeca-6,9,12-trienoyl]oxy-2-undecanoyloxypropoxy]phosphoryl]oxypropanoic acid.
| Compound Name | (2R)-2-amino-3-[hydroxy-[(2S)-3-[(6E,9E,12E)-octadeca-6,9,12-trienoyl]oxy-2-undecanoyloxypropoxy]phosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 134719693 |
| Molecular Formula | C35H62NO10P |
| Molecular Weight | 687.85 g/mol |
| Exact Mass | 687.41 |
| IUPAC Name | (2R)-2-amino-3-[hydroxy-[(2S)-3-[(6E,9E,12E)-octadeca-6,9,12-trienoyl]oxy-2-undecanoyloxypropoxy]phosphoryl]oxypropanoic acid |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/CCCCC(=O)OC[C@@H](COP(=O)(O)OC[C@@H](N)C(=O)O)OC(=O)CCCCCCCCCC |
| InChI | InChI=1S/C35H62NO10P/c1-3-5-7-9-11-13-14-15-16-17-18-19-21-22-24-26-33(37)43-28-31(29-44-47(41,42)45-30-32(36)35(39)40)46-34(38)27-25-23-20-12-10-8-6-4-2/h11,13,15-16,18-19,31-32H,3-10,12,14,17,20-30,36H2,1-2H3,(H,39,40)(H,41,42)/b13-11+,16-15+,19-18+/t31-,32+/m0/s1 |
| InChIKey | AVRHTJZVDBKXAL-IHTZYYQHSA-N |
| XLogP | 8.11 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.85 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|