C44H80NO10P — CID 134728942
(2S)-2-amino-3-[hydroxy-[(2R)-3-[(E)-icos-11-enoyl]oxy-2-[(9E,12E)-octadeca-9,12-dienoyl]oxypropoxy]phosphoryl]oxypropanoic acid (PubChem CID 134728942) has the molecular formula C44H80NO10P and a molecular weight of 814.09 g/mol. Its IUPAC name is (2S)-2-amino-3-[hydroxy-[(2R)-3-[(E)-icos-11-enoyl]oxy-2-[(9E,12E)-octadeca-9,12-dienoyl]oxypropoxy]phosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[hydroxy-[(2R)-3-[(E)-icos-11-enoyl]oxy-2-[(9E,12E)-octadeca-9,12-dienoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 134728942 |
| Molecular Formula | C44H80NO10P |
| Molecular Weight | 814.09 g/mol |
| Exact Mass | 813.55 |
| IUPAC Name | (2S)-2-amino-3-[hydroxy-[(2R)-3-[(E)-icos-11-enoyl]oxy-2-[(9E,12E)-octadeca-9,12-dienoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCCCC/C=C/CCCCCCCC)COP(=O)(O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C44H80NO10P/c1-3-5-7-9-11-13-15-17-19-20-22-23-25-27-29-31-33-35-42(46)52-37-40(38-53-56(50,51)54-39-41(45)44(48)49)55-43(47)36-34-32-30-28-26-24-21-18-16-14-12-10-8-6-4-2/h12,14,17-19,21,40-41H,3-11,13,15-16,20,22-39,45H2,1-2H3,(H,48,49)(H,50,51)/b14-12+,19-17+,21-18+/t40-,41+/m1/s1 |
| InChIKey | FCLNGSFLMPNUCH-GAFAHMCYSA-N |
| XLogP | 11.62 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.09 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|