C48H84NO10P — CID 134737143
(2S)-2-amino-3-[[(2R)-3-[(7E,10E,13E,16E)-docosa-7,10,13,16-tetraenoyl]oxy-2-[(E)-icos-11-enoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 134737143) has the molecular formula C48H84NO10P and a molecular weight of 866.17 g/mol. Its IUPAC name is (2S)-2-amino-3-[[(2R)-3-[(7E,10E,13E,16E)-docosa-7,10,13,16-tetraenoyl]oxy-2-[(E)-icos-11-enoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[[(2R)-3-[(7E,10E,13E,16E)-docosa-7,10,13,16-tetraenoyl]oxy-2-[(E)-icos-11-enoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 134737143 |
| Molecular Formula | C48H84NO10P |
| Molecular Weight | 866.17 g/mol |
| Exact Mass | 865.58 |
| IUPAC Name | (2S)-2-amino-3-[[(2R)-3-[(7E,10E,13E,16E)-docosa-7,10,13,16-tetraenoyl]oxy-2-[(E)-icos-11-enoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/C/C=C/CCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@H](N)C(=O)O)OC(=O)CCCCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C48H84NO10P/c1-3-5-7-9-11-13-15-17-19-21-22-24-25-27-29-31-33-35-37-39-46(50)56-41-44(42-57-60(54,55)58-43-45(49)48(52)53)59-47(51)40-38-36-34-32-30-28-26-23-20-18-16-14-12-10-8-6-4-2/h11,13,17-20,22,24,27,29,44-45H,3-10,12,14-16,21,23,25-26,28,30-43,49H2,1-2H3,(H,52,53)(H,54,55)/b13-11+,19-17+,20-18+,24-22+,29-27+/t44-,45+/m1/s1 |
| InChIKey | HZHKJJFLCQEELZ-PJEXBQOCSA-N |
| XLogP | 12.73 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.17 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|