C17H19NO7 — CID 154574218
(2,2-diacetyloxy-1-benzyl-5-oxopyrrolidin-3-yl) acetate (PubChem CID 154574218) has the molecular formula C17H19NO7 and a molecular weight of 349.34 g/mol. Its IUPAC name is (2,2-diacetyloxy-1-benzyl-5-oxopyrrolidin-3-yl) acetate.
| Compound Name | (2,2-diacetyloxy-1-benzyl-5-oxopyrrolidin-3-yl) acetate |
|---|---|
| PubChem CID | 154574218 |
| Molecular Formula | C17H19NO7 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (2,2-diacetyloxy-1-benzyl-5-oxopyrrolidin-3-yl) acetate |
| SMILES | CC(=O)OC1CC(=O)N(Cc2ccccc2)C1(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C17H19NO7/c1-11(19)23-15-9-16(22)18(10-14-7-5-4-6-8-14)17(15,24-12(2)20)25-13(3)21/h4-8,15H,9-10H2,1-3H3 |
| InChIKey | HYKCDMKMUFGORG-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|