C20H27N5O — CID 154575604
5-[4-[4-(4-methylpiperazin-1-yl)but-2-ynoxy]piperidin-1-yl]pyridine-2-carbonitrile (PubChem CID 154575604) has the molecular formula C20H27N5O and a molecular weight of 353.47 g/mol. Its IUPAC name is 5-[4-[4-(4-methylpiperazin-1-yl)but-2-ynoxy]piperidin-1-yl]pyridine-2-carbonitrile.
| Compound Name | 5-[4-[4-(4-methylpiperazin-1-yl)but-2-ynoxy]piperidin-1-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 154575604 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 5-[4-[4-(4-methylpiperazin-1-yl)but-2-ynoxy]piperidin-1-yl]pyridine-2-carbonitrile |
| SMILES | CN1CCN(CC#CCOC2CCN(c3ccc(C#N)nc3)CC2)CC1 |
| InChI | InChI=1S/C20H27N5O/c1-23-11-13-24(14-12-23)8-2-3-15-26-20-6-9-25(10-7-20)19-5-4-18(16-21)22-17-19/h4-5,17,20H,6-15H2,1H3 |
| InChIKey | RTDYROVWICHLRH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 55.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|