C20H30FN5O — CID 146079500
4-ethyl-5-fluoro-6-[4-[4-(4-methylpiperazin-1-yl)but-2-ynoxy]piperidin-1-yl]pyrimidine (PubChem CID 146079500) has the molecular formula C20H30FN5O and a molecular weight of 375.49 g/mol. Its IUPAC name is 4-ethyl-5-fluoro-6-[4-[4-(4-methylpiperazin-1-yl)but-2-ynoxy]piperidin-1-yl]pyrimidine.
| Compound Name | 4-ethyl-5-fluoro-6-[4-[4-(4-methylpiperazin-1-yl)but-2-ynoxy]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 146079500 |
| Molecular Formula | C20H30FN5O |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 4-ethyl-5-fluoro-6-[4-[4-(4-methylpiperazin-1-yl)but-2-ynoxy]piperidin-1-yl]pyrimidine |
| SMILES | CCc1ncnc(N2CCC(OCC#CCN3CCN(C)CC3)CC2)c1F |
| InChI | InChI=1S/C20H30FN5O/c1-3-18-19(21)20(23-16-22-18)26-9-6-17(7-10-26)27-15-5-4-8-25-13-11-24(2)12-14-25/h16-17H,3,6-15H2,1-2H3 |
| InChIKey | CFMKSQKHZIACRG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|