C22H35N5O — CID 154853817
4,5-dimethyl-6-[4-[4-(4-propan-2-ylpiperazin-1-yl)but-2-ynoxy]piperidin-1-yl]pyrimidine (PubChem CID 154853817) has the molecular formula C22H35N5O and a molecular weight of 385.56 g/mol. Its IUPAC name is 4,5-dimethyl-6-[4-[4-(4-propan-2-ylpiperazin-1-yl)but-2-ynoxy]piperidin-1-yl]pyrimidine.
| Compound Name | 4,5-dimethyl-6-[4-[4-(4-propan-2-ylpiperazin-1-yl)but-2-ynoxy]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 154853817 |
| Molecular Formula | C22H35N5O |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | 4,5-dimethyl-6-[4-[4-(4-propan-2-ylpiperazin-1-yl)but-2-ynoxy]piperidin-1-yl]pyrimidine |
| SMILES | Cc1ncnc(N2CCC(OCC#CCN3CCN(C(C)C)CC3)CC2)c1C |
| InChI | InChI=1S/C22H35N5O/c1-18(2)26-14-12-25(13-15-26)9-5-6-16-28-21-7-10-27(11-8-21)22-19(3)20(4)23-17-24-22/h17-18,21H,7-16H2,1-4H3 |
| InChIKey | HVUIWLOHAFLHDW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|